CAS 2344679-91-8 is the registry number for 4-Bromo-2,2-difluoro-2,3-dihydro-1H-inden-1-ol, 95%. Offered by: AmBeed. Available pack sizes: 1g.
4-bromo-2,2-difluoro-1,3-dihydroinden-1-ol (CAS 2344679-91-8) is a chemical compound with the molecular formula C9H7BrF2O and a molecular weight of 249.05 g/mol. IUPAC name: 4-bromo-2,2-difluoro-1,3-dihydroinden-1-ol. InChIKey: VFJXHOSBHFVREH-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF2O |
|---|---|
| Molecular weight | 249.05 g/mol |
| IUPAC name | 4-bromo-2,2-difluoro-1,3-dihydroinden-1-ol |
| InChIKey | VFJXHOSBHFVREH-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC=C2Br)C(C1(F)F)O |
Computed by PubChem (NCBI)