Products 186036-04-4
CAS 186036-04-4 appears in our catalog under these names: 2-Bromo-1-(2,5-difluorophenyl)propan-1-one, 95%, 2-Bromo-2',5'-difluoropropiophenone. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 5g, 1g.
2-bromo-1-(2,5-difluorophenyl)propan-1-one (CAS 186036-04-4) is a chemical compound with the molecular formula C9H7BrF2O and a molecular weight of 249.05 g/mol. IUPAC name: 2-bromo-1-(2,5-difluorophenyl)propan-1-one. InChIKey: RVYATSSPBCRXII-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF2O |
|---|---|
| Molecular weight | 249.05 g/mol |
| IUPAC name | 2-bromo-1-(2,5-difluorophenyl)propan-1-one |
| InChIKey | RVYATSSPBCRXII-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=C(C=CC(=C1)F)F)Br |
Computed by PubChem (NCBI)