Products 897934-99-5
CAS 897934-99-5 appears in our catalog under these names: 1-(4-Bromophenyl)-1,1-difluoropropan-2-one, 95%, 1-(4-Bromophenyl)-1,1-difluoropropan-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
1-(4-bromophenyl)-1,1-difluoropropan-2-one (CAS 897934-99-5) is a chemical compound with the molecular formula C9H7BrF2O and a molecular weight of 249.05 g/mol. IUPAC name: 1-(4-bromophenyl)-1,1-difluoropropan-2-one. InChIKey: PGARJEGPWFGHKP-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF2O |
|---|---|
| Molecular weight | 249.05 g/mol |
| IUPAC name | 1-(4-bromophenyl)-1,1-difluoropropan-2-one |
| InChIKey | PGARJEGPWFGHKP-UHFFFAOYSA-N |
| SMILES | CC(=O)C(C1=CC=C(C=C1)Br)(F)F |
Computed by PubChem (NCBI)