CAS 2488795-13-5 is the registry number for 8-Bromo-4,4-difluoroisochromane, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-bromo-4,4-difluoro-1,3-dihydroisochromene (CAS 2488795-13-5) is a chemical compound with the molecular formula C9H7BrF2O and a molecular weight of 249.05 g/mol. IUPAC name: 8-bromo-4,4-difluoro-1,3-dihydroisochromene. InChIKey: LBPDZIJMKZJWKU-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF2O |
|---|---|
| Molecular weight | 249.05 g/mol |
| IUPAC name | 8-bromo-4,4-difluoro-1,3-dihydroisochromene |
| InChIKey | LBPDZIJMKZJWKU-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC=C2Br)C(CO1)(F)F |
Computed by PubChem (NCBI)