CAS 1783557-72-1 is the registry number for 7-Bromo-4,4-difluorochromane, 95%. Offered by: AmBeed. Available pack sizes: 1g.
7-bromo-4,4-difluoro-2,3-dihydrochromene (CAS 1783557-72-1) is a chemical compound with the molecular formula C9H7BrF2O and a molecular weight of 249.05 g/mol. IUPAC name: 7-bromo-4,4-difluoro-2,3-dihydrochromene. InChIKey: STADVUZYLPCMFW-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF2O |
|---|---|
| Molecular weight | 249.05 g/mol |
| IUPAC name | 7-bromo-4,4-difluoro-2,3-dihydrochromene |
| InChIKey | STADVUZYLPCMFW-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C1(F)F)C=CC(=C2)Br |
Computed by PubChem (NCBI)