Products 143436-36-6
CAS 143436-36-6 appears in our catalog under these names: Pranoprofen Impurity 6, Pranoprofen Impurity 5. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
1-(5H-chromeno[2,3-b]pyridin-7-yl)-1,1-dimethoxypropan-2-ol (CAS 143436-36-6) is a chemical compound with the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. IUPAC name: 1-(5H-chromeno[2,3-b]pyridin-7-yl)-1,1-dimethoxypropan-2-ol. InChIKey: STKAXAKNBKHQKP-UHFFFAOYSA-N.
| Molecular formula | C17H19NO4 |
|---|---|
| Molecular weight | 301.34 g/mol |
| IUPAC name | 1-(5H-chromeno[2,3-b]pyridin-7-yl)-1,1-dimethoxypropan-2-ol |
| InChIKey | STKAXAKNBKHQKP-UHFFFAOYSA-N |
| SMILES | CC(C(C1=CC2=C(C=C1)OC3=C(C2)C=CC=N3)(OC)OC)O |
Computed by PubChem (NCBI)