Products 1434631-44-3
CAS 1434631-44-3 appears in our catalog under these names: 2-Amino-3-bromo-5-(trifluoromethyl)benzoic acid, 97%, 2-Amino-3-bromo-5-(trifluoromethyl)benzoic acid, 98%. Offered by: Ambeed, Chemat, Fluorochem, BLDpharm. Available pack sizes: 100mg, 250mg, 1g, 5g, 500mg.
2-amino-3-bromo-5-(trifluoromethyl)benzoic acid (CAS 1434631-44-3) is a chemical compound with the molecular formula C8H5BrF3NO2 and a molecular weight of 284.03 g/mol. IUPAC name: 2-amino-3-bromo-5-(trifluoromethyl)benzoic acid. InChIKey: JEYCNCNKTWYLBJ-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF3NO2 |
|---|---|
| Molecular weight | 284.03 g/mol |
| IUPAC name | 2-amino-3-bromo-5-(trifluoromethyl)benzoic acid |
| InChIKey | JEYCNCNKTWYLBJ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)N)Br)C(F)(F)F |
Computed by PubChem (NCBI)