Products 1435934-57-8
CAS 1435934-57-8 appears in our catalog under these names: Norketamine-D4 Hydrochloride 0.1 mg/ml in Methanol (as free base), Norketamine–d4 (hydrochloride). Offered by: LoGiCal, GLPBio. Available pack sizes: 1ml, 1mg, 500μg.
2-amino-2-(2-chloro-3,4,5,6-tetradeuteriophenyl)cyclohexan-1-one;hydrochloride (CAS 1435934-57-8) is a chemical compound with the molecular formula C12H15Cl2NO and a molecular weight of 264.18 g/mol. IUPAC name: 2-amino-2-(2-chloro-3,4,5,6-tetradeuteriophenyl)cyclohexan-1-one;hydrochloride. InChIKey: CLPOJGPBUGCUKT-LZLIYGNZSA-N.
| Molecular formula | C12H15Cl2NO |
|---|---|
| Molecular weight | 264.18 g/mol |
| IUPAC name | 2-amino-2-(2-chloro-3,4,5,6-tetradeuteriophenyl)cyclohexan-1-one;hydrochloride |
| InChIKey | CLPOJGPBUGCUKT-LZLIYGNZSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C2(CCCCC2=O)N)Cl)[2H])[2H].Cl |
Computed by PubChem (NCBI)