CAS 143608-10-0 is the registry number for 1-(5-Amino-2,3-dihydro-1h-indol-1-yl)ethan-1-one hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g.
1-(5-amino-2,3-dihydroindol-1-yl)ethanone;hydrochloride (CAS 143608-10-0) is a chemical compound with the molecular formula C10H13ClN2O and a molecular weight of 212.67 g/mol. IUPAC name: 1-(5-amino-2,3-dihydroindol-1-yl)ethanone;hydrochloride. InChIKey: CCCXGUDRZSRQIT-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2O |
|---|---|
| Molecular weight | 212.67 g/mol |
| IUPAC name | 1-(5-amino-2,3-dihydroindol-1-yl)ethanone;hydrochloride |
| InChIKey | CCCXGUDRZSRQIT-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CCC2=C1C=CC(=C2)N.Cl |
Computed by PubChem (NCBI)