Products 1436619-60-1
CAS 1436619-60-1 appears in our catalog under these names: (3-Methyl-4-nitrophenyl)boronic acid, 95%, 95%, (3-Methyl-4-nitrophenyl)boronic acid, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 5g, 250mg.
(3-methyl-4-nitrophenyl)boronic acid (CAS 1436619-60-1) is a chemical compound with the molecular formula C7H8BNO4 and a molecular weight of 180.96 g/mol. IUPAC name: (3-methyl-4-nitrophenyl)boronic acid. InChIKey: MCOWIWZRZDFDRN-UHFFFAOYSA-N.
| Molecular formula | C7H8BNO4 |
|---|---|
| Molecular weight | 180.96 g/mol |
| IUPAC name | (3-methyl-4-nitrophenyl)boronic acid |
| InChIKey | MCOWIWZRZDFDRN-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)[N+](=O)[O-])C)(O)O |
Computed by PubChem (NCBI)