CAS 143665-37-6 appears in our catalog under these names: 2–(3–Methyl–4–nitrophenyl)acetic acid, (3-Methyl-4-nitrophenyl)acetic acid, 2-(3-Methyl-4-nitrophenyl)acetic acid 97%, 2-(3-Methyl-4-nitrophenyl)acetic Acid, 97%, 97%, 3-METHYL-4-NITROPHENYL ACETIC ACID, 98%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 10g, 250mg.
2-(3-methyl-4-nitrophenyl)acetic acid (CAS 143665-37-6) is a chemical compound with the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. IUPAC name: 2-(3-methyl-4-nitrophenyl)acetic acid. InChIKey: NUYOXESWWGUDLP-UHFFFAOYSA-N.
| Molecular formula | C9H9NO4 |
|---|---|
| Molecular weight | 195.17 g/mol |
| IUPAC name | 2-(3-methyl-4-nitrophenyl)acetic acid |
| InChIKey | NUYOXESWWGUDLP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)CC(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)