CAS 1437-57-6 appears in our catalog under these names: N,5-Diphenyl-1,3,4-thiadiazol-2-amine, 98%, N,5-diphenyl-1,3,4-thiadiazol-2-amine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 10mg, 50mg.
N,5-diphenyl-1,3,4-thiadiazol-2-amine (CAS 1437-57-6) is a chemical compound with the molecular formula C14H11N3S and a molecular weight of 253.32 g/mol. IUPAC name: N,5-diphenyl-1,3,4-thiadiazol-2-amine. InChIKey: OBDULOLVDJHSJL-UHFFFAOYSA-N.
| Molecular formula | C14H11N3S |
|---|---|
| Molecular weight | 253.32 g/mol |
| IUPAC name | N,5-diphenyl-1,3,4-thiadiazol-2-amine |
| InChIKey | OBDULOLVDJHSJL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN=C(S2)NC3=CC=CC=C3 |
Computed by PubChem (NCBI)