CAS 6596-82-3 appears in our catalog under these names: 4,5-Diphenyl-4H-1,2,4-triazole-3-thiol, 4,5-Diphenyl-4h-1,2,4-triazole-3-thiol, 95%, 4,5-Diphenyl-4H-1,2,4-triazole-3-thiol, 95+%. Offered by: Chemat, Fluorochem, Combi-blocks, AmBeed. Available pack sizes: 10mg, 50mg, 1g, 5g.
3,4-diphenyl-1H-1,2,4-triazole-5-thione (CAS 6596-82-3) is a chemical compound with the molecular formula C14H11N3S and a molecular weight of 253.32 g/mol. IUPAC name: 3,4-diphenyl-1H-1,2,4-triazole-5-thione. InChIKey: QGTQPTZBBLHLBV-UHFFFAOYSA-N.
| Molecular formula | C14H11N3S |
|---|---|
| Molecular weight | 253.32 g/mol |
| IUPAC name | 3,4-diphenyl-1H-1,2,4-triazole-5-thione |
| InChIKey | QGTQPTZBBLHLBV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NNC(=S)N2C3=CC=CC=C3 |
Computed by PubChem (NCBI)