CAS 70057-66-8 is the registry number for 5-(4-phenylphenyl)-1,3,4-thiadiazol-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
5-(4-phenylphenyl)-1,3,4-thiadiazol-2-amine (CAS 70057-66-8) is a chemical compound with the molecular formula C14H11N3S and a molecular weight of 253.32 g/mol. IUPAC name: 5-(4-phenylphenyl)-1,3,4-thiadiazol-2-amine. InChIKey: HMBUEMMYOIVIOM-UHFFFAOYSA-N.
| Molecular formula | C14H11N3S |
|---|---|
| Molecular weight | 253.32 g/mol |
| IUPAC name | 5-(4-phenylphenyl)-1,3,4-thiadiazol-2-amine |
| InChIKey | HMBUEMMYOIVIOM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3=NN=C(S3)N |
Computed by PubChem (NCBI)