CAS 17467-60-6 is the registry number for N,3-diphenyl-1,2,4-thiadiazol-5-amine, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 250mg, 1g.
N,3-diphenyl-1,2,4-thiadiazol-5-amine (CAS 17467-60-6) is a chemical compound with the molecular formula C14H11N3S and a molecular weight of 253.32 g/mol. IUPAC name: N,3-diphenyl-1,2,4-thiadiazol-5-amine. InChIKey: RMFQIIXCTLNZRC-UHFFFAOYSA-N.
| Molecular formula | C14H11N3S |
|---|---|
| Molecular weight | 253.32 g/mol |
| IUPAC name | N,3-diphenyl-1,2,4-thiadiazol-5-amine |
| InChIKey | RMFQIIXCTLNZRC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NSC(=N2)NC3=CC=CC=C3 |
Computed by PubChem (NCBI)