CAS 159081-22-8 is the registry number for YM-31636 (free base), 99.05%. Offered by: MedChemExpress. Available pack sizes: 10mM/1mL, 10 mg, 50 mg, 100 mg, 5 mg, 25 mg.
2-(1H-imidazol-5-ylmethyl)-4H-indeno[1,2-d][1,3]thiazole (CAS 159081-22-8) is a chemical compound with the molecular formula C14H11N3S and a molecular weight of 253.32 g/mol. IUPAC name: 2-(1H-imidazol-5-ylmethyl)-4H-indeno[1,2-d][1,3]thiazole. InChIKey: SWXJBBYBDXFMGG-UHFFFAOYSA-N.
| Molecular formula | C14H11N3S |
|---|---|
| Molecular weight | 253.32 g/mol |
| IUPAC name | 2-(1H-imidazol-5-ylmethyl)-4H-indeno[1,2-d][1,3]thiazole |
| InChIKey | SWXJBBYBDXFMGG-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C3=C1SC(=N3)CC4=CN=CN4 |
Computed by PubChem (NCBI)