Products 1438281-31-2

CAS 1438281-31-2 is the registry number for 1’-Cbz-3H-spiro[isobenzofuran-1,4’-piperidin]-3-one, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

Benzyl 3-oxospiro[2-benzofuran-1,4'-piperidine]-1'-carboxylate (CAS 1438281-31-2) is a chemical compound with the molecular formula C20H19NO4 and a molecular weight of 337.4 g/mol. IUPAC name: benzyl 3-oxospiro[2-benzofuran-1,4'-piperidine]-1'-carboxylate. InChIKey: LWXMODUVFYFHME-UHFFFAOYSA-N.

Identity
Molecular formulaC20H19NO4
Molecular weight337.4 g/mol
IUPAC namebenzyl 3-oxospiro[2-benzofuran-1,4'-piperidine]-1'-carboxylate
InChIKeyLWXMODUVFYFHME-UHFFFAOYSA-N
SMILESC1CN(CCC12C3=CC=CC=C3C(=O)O2)C(=O)OCC4=CC=CC=C4

Computed by PubChem (NCBI)