Products 143935-63-1
CAS 143935-63-1 is the registry number for (2R)-2-{[(tert-butoxy)carbonyl]amino}-3-methanesulfonylpropanoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-methylsulfonylpropanoic acid (CAS 143935-63-1) is a chemical compound with the molecular formula C9H17NO6S and a molecular weight of 267.30 g/mol. IUPAC name: (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-methylsulfonylpropanoic acid. InChIKey: IUTMQUCKMRHKCR-LURJTMIESA-N.
| Molecular formula | C9H17NO6S |
|---|---|
| Molecular weight | 267.30 g/mol |
| IUPAC name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-methylsulfonylpropanoic acid |
| InChIKey | IUTMQUCKMRHKCR-LURJTMIESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CS(=O)(=O)C)C(=O)O |
Computed by PubChem (NCBI)