CAS 2097417-90-6 is the registry number for tert-Butyl (R)-4-(methoxymethyl)-1,2,3-oxathiazolidine-3-carboxylate 2,2-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (4R)-4-(methoxymethyl)-2,2-dioxooxathiazolidine-3-carboxylate (CAS 2097417-90-6) is a chemical compound with the molecular formula C9H17NO6S and a molecular weight of 267.30 g/mol. IUPAC name: tert-butyl (4R)-4-(methoxymethyl)-2,2-dioxooxathiazolidine-3-carboxylate. InChIKey: ORWHXHCSDYWSCI-SSDOTTSWSA-N.
| Molecular formula | C9H17NO6S |
|---|---|
| Molecular weight | 267.30 g/mol |
| IUPAC name | tert-butyl (4R)-4-(methoxymethyl)-2,2-dioxooxathiazolidine-3-carboxylate |
| InChIKey | ORWHXHCSDYWSCI-SSDOTTSWSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@@H](COS1(=O)=O)COC |
Computed by PubChem (NCBI)