Products 152983-87-4
CAS 152983-87-4 is the registry number for 2-(L-Fuco-tetrahydroxypentyl)-4(R)-1,3-thiazolidine-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 500mg, 250mg, 1000mg, 5000mg, 2000mg.
(4R)-2-[(1S,2R,3R,4S)-1,2,3,4-tetrahydroxypentyl]-1,3-thiazolidine-4-carboxylic acid (CAS 152983-87-4) is a chemical compound with the molecular formula C9H17NO6S and a molecular weight of 267.30 g/mol. IUPAC name: (4R)-2-[(1S,2R,3R,4S)-1,2,3,4-tetrahydroxypentyl]-1,3-thiazolidine-4-carboxylic acid. InChIKey: GUBDMLZXXIDYSG-ICSJMDSJSA-N.
| Molecular formula | C9H17NO6S |
|---|---|
| Molecular weight | 267.30 g/mol |
| IUPAC name | (4R)-2-[(1S,2R,3R,4S)-1,2,3,4-tetrahydroxypentyl]-1,3-thiazolidine-4-carboxylic acid |
| InChIKey | GUBDMLZXXIDYSG-ICSJMDSJSA-N |
| SMILES | C[C@@H]([C@H]([C@H]([C@@H](C1N[C@@H](CS1)C(=O)O)O)O)O)O |
Computed by PubChem (NCBI)