CAS 205249-06-5 is the registry number for Des-(4,5-O-(1-methylethylidene)) Topiramate. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 25mg, 50mg.
[(3aS,7aS)-2,2-dimethyl-5,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-b]pyran-3a-yl]methyl sulfamate (CAS 205249-06-5) is a chemical compound with the molecular formula C9H17NO6S and a molecular weight of 267.30 g/mol. IUPAC name: [(3aS,7aS)-2,2-dimethyl-5,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-b]pyran-3a-yl]methyl sulfamate. InChIKey: JVSDDGIQDGRFGK-CBAPKCEASA-N.
| Molecular formula | C9H17NO6S |
|---|---|
| Molecular weight | 267.30 g/mol |
| IUPAC name | [(3aS,7aS)-2,2-dimethyl-5,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-b]pyran-3a-yl]methyl sulfamate |
| InChIKey | JVSDDGIQDGRFGK-CBAPKCEASA-N |
| SMILES | CC1(O[C@H]2CCCO[C@]2(O1)COS(=O)(=O)N)C |
Computed by PubChem (NCBI)