CAS 61145-44-6 is the registry number for 2-Imino-2-methoxyethyl-1-deoxy-1-thio-a-D-mannopyranoside. Offered by: Biosynth. Available pack sizes: 100mg, 50mg, 250mg.
2-imino-2-methoxyethyl 1-thio-alpha-D-mannopyranoside is a thioglycoside in which 1-thio-alpha-D-mannopyranose is glycosylated at sulfur with a 2-imino-2-methoxyethyl group.
Source: ChEBI
| Molecular formula | C9H17NO6S |
|---|---|
| Molecular weight | 267.30 g/mol |
| IUPAC name | methyl 2-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylethanimidate |
| InChIKey | QMZQMASPATYOGL-RZNRLUQXSA-N |
| SMILES | COC(=N)CS[C@@H]1[C@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
Computed by PubChem (NCBI)