Products 2023006-04-2

CAS 2023006-04-2 is the registry number for tert-Butyl 4-(methoxymethyl)-1,2,3-oxathiazolidine-3-carboxylate 2,2-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Tert-butyl 4-(methoxymethyl)-2,2-dioxooxathiazolidine-3-carboxylate (CAS 2023006-04-2) is a chemical compound with the molecular formula C9H17NO6S and a molecular weight of 267.30 g/mol. IUPAC name: tert-butyl 4-(methoxymethyl)-2,2-dioxooxathiazolidine-3-carboxylate. InChIKey: ORWHXHCSDYWSCI-UHFFFAOYSA-N.

Identity
Molecular formulaC9H17NO6S
Molecular weight267.30 g/mol
IUPAC nametert-butyl 4-(methoxymethyl)-2,2-dioxooxathiazolidine-3-carboxylate
InChIKeyORWHXHCSDYWSCI-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1C(COS1(=O)=O)COC

Computed by PubChem (NCBI)