CAS 1439373-47-3 appears in our catalog under these names: (2S)-4-((Benzyloxy)carbonyl)morpholine-2-carboxylic acid, 98%, (2S)-4-[(Benzyloxy)carbonyl]morpholine-2-carboxylic acid, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 10g, 1g, 5g.
(2S)-4-phenylmethoxycarbonylmorpholine-2-carboxylic acid (CAS 1439373-47-3) is a chemical compound with the molecular formula C13H15NO5 and a molecular weight of 265.26 g/mol. IUPAC name: (2S)-4-phenylmethoxycarbonylmorpholine-2-carboxylic acid. InChIKey: AVQCLRKABAZVMZ-NSHDSACASA-N.
| Molecular formula | C13H15NO5 |
|---|---|
| Molecular weight | 265.26 g/mol |
| IUPAC name | (2S)-4-phenylmethoxycarbonylmorpholine-2-carboxylic acid |
| InChIKey | AVQCLRKABAZVMZ-NSHDSACASA-N |
| SMILES | C1CO[C@@H](CN1C(=O)OCC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)