CAS 1439900-08-9 appears in our catalog under these names: 2,2-Dimethyl-3-(2-(trifluoromethyl)phenyl)propanoic acid, 98%, 2,2-Dimethyl-3-(2-(trifluoromethyl)phenyl)propanoic acid, 97%, 97%, 2,2-Dimethyl-3-[2-(trifluoromethyl)phenyl]propanoic acid, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
2,2-dimethyl-3-[2-(trifluoromethyl)phenyl]propanoic acid (CAS 1439900-08-9) is a chemical compound with the molecular formula C12H13F3O2 and a molecular weight of 246.22 g/mol. IUPAC name: 2,2-dimethyl-3-[2-(trifluoromethyl)phenyl]propanoic acid. InChIKey: BTNAJJCQPRTWGY-UHFFFAOYSA-N.
| Molecular formula | C12H13F3O2 |
|---|---|
| Molecular weight | 246.22 g/mol |
| IUPAC name | 2,2-dimethyl-3-[2-(trifluoromethyl)phenyl]propanoic acid |
| InChIKey | BTNAJJCQPRTWGY-UHFFFAOYSA-N |
| SMILES | CC(C)(CC1=CC=CC=C1C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)