Products 1440531-71-4
CAS 1440531-71-4 is the registry number for (2R,3S)-3-Hydroxy-2-(1-oxo-1,3-dihydro-2h-isoindol-2-yl)butanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
(2R,3S)-3-hydroxy-2-(3-oxo-1H-isoindol-2-yl)butanoic acid (CAS 1440531-71-4) is a chemical compound with the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. IUPAC name: (2R,3S)-3-hydroxy-2-(3-oxo-1H-isoindol-2-yl)butanoic acid. InChIKey: WVAPGRWEWVICJY-OIBJUYFYSA-N.
| Molecular formula | C12H13NO4 |
|---|---|
| Molecular weight | 235.24 g/mol |
| IUPAC name | (2R,3S)-3-hydroxy-2-(3-oxo-1H-isoindol-2-yl)butanoic acid |
| InChIKey | WVAPGRWEWVICJY-OIBJUYFYSA-N |
| SMILES | C[C@@H]([C@H](C(=O)O)N1CC2=CC=CC=C2C1=O)O |
Computed by PubChem (NCBI)