CAS 144084-34-4 is the registry number for N-tert-Butyl-2-chloropyridine-3-carboxamide, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
N-tert-butyl-2-chloropyridine-3-carboxamide (CAS 144084-34-4) is a chemical compound with the molecular formula C10H13ClN2O and a molecular weight of 212.67 g/mol. IUPAC name: N-tert-butyl-2-chloropyridine-3-carboxamide. InChIKey: XDNZKESLUSNPBO-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2O |
|---|---|
| Molecular weight | 212.67 g/mol |
| IUPAC name | N-tert-butyl-2-chloropyridine-3-carboxamide |
| InChIKey | XDNZKESLUSNPBO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC(=O)C1=C(N=CC=C1)Cl |
Computed by PubChem (NCBI)