Products 1442643-22-2
CAS 1442643-22-2 appears in our catalog under these names: 5-Bromo-3-hydroxy-2-methylbenzoic acid, 95%, 5-Bromo-3-hydroxy-2-methylbenzoic acid 97%, 5-BROMO-3-HYDROXY-2-METHYLBENZOIC ACID, 97%, 5-Bromo-3-hydroxy-2-methylbenzoic acid, 97%, 97%. Offered by: Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 250mg, 5g, 1g, 100mg.
5-bromo-3-hydroxy-2-methylbenzoic acid (CAS 1442643-22-2) is a chemical compound with the molecular formula C8H7BrO3 and a molecular weight of 231.04 g/mol. IUPAC name: 5-bromo-3-hydroxy-2-methylbenzoic acid. InChIKey: YYQFFQBAZQFKQK-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO3 |
|---|---|
| Molecular weight | 231.04 g/mol |
| IUPAC name | 5-bromo-3-hydroxy-2-methylbenzoic acid |
| InChIKey | YYQFFQBAZQFKQK-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1O)Br)C(=O)O |
Computed by PubChem (NCBI)