CAS 1443252-76-3 appears in our catalog under these names: H-4,4-DiMe-Pro-OH HCl 97%, (S)-4,4-Dimethylpyrrolidine-2-carboxylic acid hydrochloride, 97%, 97%, 4,4-Dimethyl-L-proline hydrochloride, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
(2S)-4,4-dimethylpyrrolidine-2-carboxylic acid;hydrochloride (CAS 1443252-76-3) is a chemical compound with the molecular formula C7H14ClNO2 and a molecular weight of 179.64 g/mol. IUPAC name: (2S)-4,4-dimethylpyrrolidine-2-carboxylic acid;hydrochloride. InChIKey: RTSRUEOIZRIOBZ-JEDNCBNOSA-N.
| Molecular formula | C7H14ClNO2 |
|---|---|
| Molecular weight | 179.64 g/mol |
| IUPAC name | (2S)-4,4-dimethylpyrrolidine-2-carboxylic acid;hydrochloride |
| InChIKey | RTSRUEOIZRIOBZ-JEDNCBNOSA-N |
| SMILES | CC1(C[C@H](NC1)C(=O)O)C.Cl |
Computed by PubChem (NCBI)