CAS 2306255-31-0 is the registry number for (R)-4,4-Dimethylpyrrolidine-2-carboxylic acid hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-4,4-dimethylpyrrolidine-2-carboxylic acid;hydrochloride (CAS 2306255-31-0) is a chemical compound with the molecular formula C7H14ClNO2 and a molecular weight of 179.64 g/mol. IUPAC name: (2R)-4,4-dimethylpyrrolidine-2-carboxylic acid;hydrochloride. InChIKey: RTSRUEOIZRIOBZ-NUBCRITNSA-N.
| Molecular formula | C7H14ClNO2 |
|---|---|
| Molecular weight | 179.64 g/mol |
| IUPAC name | (2R)-4,4-dimethylpyrrolidine-2-carboxylic acid;hydrochloride |
| InChIKey | RTSRUEOIZRIOBZ-NUBCRITNSA-N |
| SMILES | CC1(C[C@@H](NC1)C(=O)O)C.Cl |
Computed by PubChem (NCBI)