Products 2306255-31-0

CAS 2306255-31-0 is the registry number for (R)-4,4-Dimethylpyrrolidine-2-carboxylic acid hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(2R)-4,4-dimethylpyrrolidine-2-carboxylic acid;hydrochloride (CAS 2306255-31-0) is a chemical compound with the molecular formula C7H14ClNO2 and a molecular weight of 179.64 g/mol. IUPAC name: (2R)-4,4-dimethylpyrrolidine-2-carboxylic acid;hydrochloride. InChIKey: RTSRUEOIZRIOBZ-NUBCRITNSA-N.

Identity
Molecular formulaC7H14ClNO2
Molecular weight179.64 g/mol
IUPAC name(2R)-4,4-dimethylpyrrolidine-2-carboxylic acid;hydrochloride
InChIKeyRTSRUEOIZRIOBZ-NUBCRITNSA-N
SMILESCC1(C[C@@H](NC1)C(=O)O)C.Cl

Computed by PubChem (NCBI)