CAS 1443303-03-4 is the registry number for 2,2,2-Trifluoro-1-(3-methyl-4-propoxyphenyl)ethanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2,2,2-trifluoro-1-(3-methyl-4-propoxyphenyl)ethanone (CAS 1443303-03-4) is a chemical compound with the molecular formula C12H13F3O2 and a molecular weight of 246.22 g/mol. IUPAC name: 2,2,2-trifluoro-1-(3-methyl-4-propoxyphenyl)ethanone. InChIKey: VIQOKWFZKWKEKY-UHFFFAOYSA-N.
| Molecular formula | C12H13F3O2 |
|---|---|
| Molecular weight | 246.22 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-(3-methyl-4-propoxyphenyl)ethanone |
| InChIKey | VIQOKWFZKWKEKY-UHFFFAOYSA-N |
| SMILES | CCCOC1=C(C=C(C=C1)C(=O)C(F)(F)F)C |
Computed by PubChem (NCBI)