CAS 1443378-52-6 is the registry number for 5,7-Dichloro-1,6-naphthyridin-4-ol. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
5,7-dichloro-1H-1,6-naphthyridin-4-one (CAS 1443378-52-6) is a chemical compound with the molecular formula C8H4Cl2N2O and a molecular weight of 215.03 g/mol. IUPAC name: 5,7-dichloro-1H-1,6-naphthyridin-4-one. InChIKey: KFJIDHGCUDTBGV-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2O |
|---|---|
| Molecular weight | 215.03 g/mol |
| IUPAC name | 5,7-dichloro-1H-1,6-naphthyridin-4-one |
| InChIKey | KFJIDHGCUDTBGV-UHFFFAOYSA-N |
| SMILES | C1=CNC2=CC(=NC(=C2C1=O)Cl)Cl |
Computed by PubChem (NCBI)