CAS 14464-67-6 appears in our catalog under these names: (R)–2–Amino–3–(3–(trifluoromethyl)phenyl)propanoic acid, D-3-TRIFLUOROMETHYLPHENYLALANINE, 98%, 98%, (R)-2-Amino-3-(3-(trifluoromethyl)phenyl)propanoic acid, 98.0%, (R)-2-Amino-3-(3-(trifluoromethyl)phenyl)propanoic acid, 98%. Offered by: GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 250mg, 100mg, 1g, 5g, 1 g, 5 g.
(2R)-2-amino-3-[3-(trifluoromethyl)phenyl]propanoic acid (CAS 14464-67-6) is a chemical compound with the molecular formula C10H10F3NO2 and a molecular weight of 233.19 g/mol. IUPAC name: (2R)-2-amino-3-[3-(trifluoromethyl)phenyl]propanoic acid. InChIKey: BURBNIPKSRJAIQ-MRVPVSSYSA-N.
| Molecular formula | C10H10F3NO2 |
|---|---|
| Molecular weight | 233.19 g/mol |
| IUPAC name | (2R)-2-amino-3-[3-(trifluoromethyl)phenyl]propanoic acid |
| InChIKey | BURBNIPKSRJAIQ-MRVPVSSYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)