Products 1446748-33-9
CAS 1446748-33-9 is the registry number for 4′,5′-Didehydro-5′-deoxy-5-methyluridine. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[(2R,3R,4S)-3,4-dihydroxy-5-methylideneoxolan-2-yl]-5-methylpyrimidine-2,4-dione (CAS 1446748-33-9) is a chemical compound with the molecular formula C10H12N2O5 and a molecular weight of 240.21 g/mol. IUPAC name: 1-[(2R,3R,4S)-3,4-dihydroxy-5-methylideneoxolan-2-yl]-5-methylpyrimidine-2,4-dione. InChIKey: UZWBTYRRJMVEJY-ZXFLCMHBSA-N.
| Molecular formula | C10H12N2O5 |
|---|---|
| Molecular weight | 240.21 g/mol |
| IUPAC name | 1-[(2R,3R,4S)-3,4-dihydroxy-5-methylideneoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| InChIKey | UZWBTYRRJMVEJY-ZXFLCMHBSA-N |
| SMILES | CC1=CN(C(=O)NC1=O)[C@H]2[C@@H]([C@@H](C(=C)O2)O)O |
Computed by PubChem (NCBI)