CAS 1447-42-3 is the registry number for 2,3,6-Trimethylquinolin-4-ol, 97%. Offered by: AmBeed. Available pack sizes: 1g.
2,3,6-trimethyl-1H-quinolin-4-one (CAS 1447-42-3) is a chemical compound with the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. IUPAC name: 2,3,6-trimethyl-1H-quinolin-4-one. InChIKey: SNXBHMPKNBRNEJ-UHFFFAOYSA-N.
| Molecular formula | C12H13NO |
|---|---|
| Molecular weight | 187.24 g/mol |
| IUPAC name | 2,3,6-trimethyl-1H-quinolin-4-one |
| InChIKey | SNXBHMPKNBRNEJ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)NC(=C(C2=O)C)C |
Computed by PubChem (NCBI)