CAS 1447942-37-1 is the registry number for Bicyclo(3.2.1)octane-3-carboxylic acid, 8,8-difluoro-, (3-endo)-, 97%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
(1S,5R)-8,8-difluorobicyclo[3.2.1]octane-3-carboxylic acid (CAS 1447942-37-1) is a chemical compound with the molecular formula C9H12F2O2 and a molecular weight of 190.19 g/mol. IUPAC name: (1S,5R)-8,8-difluorobicyclo[3.2.1]octane-3-carboxylic acid. InChIKey: LIPBXIBHSQTLEK-DGUCWDHESA-N.
| Molecular formula | C9H12F2O2 |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | (1S,5R)-8,8-difluorobicyclo[3.2.1]octane-3-carboxylic acid |
| InChIKey | LIPBXIBHSQTLEK-DGUCWDHESA-N |
| SMILES | C1C[C@H]2CC(C[C@@H]1C2(F)F)C(=O)O |
Computed by PubChem (NCBI)