CAS 1447962-29-9 is the registry number for 3-Benzoyl-5,6,7,8-tetrahydroquinolin-2-amine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(2-amino-5,6,7,8-tetrahydroquinolin-3-yl)-phenylmethanone (CAS 1447962-29-9) is a chemical compound with the molecular formula C16H16N2O and a molecular weight of 252.31 g/mol. IUPAC name: (2-amino-5,6,7,8-tetrahydroquinolin-3-yl)-phenylmethanone. InChIKey: XIGLKCVCHGCPDO-UHFFFAOYSA-N.
| Molecular formula | C16H16N2O |
|---|---|
| Molecular weight | 252.31 g/mol |
| IUPAC name | (2-amino-5,6,7,8-tetrahydroquinolin-3-yl)-phenylmethanone |
| InChIKey | XIGLKCVCHGCPDO-UHFFFAOYSA-N |
| SMILES | C1CCC2=NC(=C(C=C2C1)C(=O)C3=CC=CC=C3)N |
Computed by PubChem (NCBI)