Products 1447965-76-5
CAS 1447965-76-5 appears in our catalog under these names: 5-Bromo-8-methoxy-1,7-naphthyridine, 5-Bromo-8-methoxy-1,7-naphthyridine, 98%, 5-Bromo-8-methoxy-1,7-naphthyridine 95%, 5-Bromo-8-methoxy-1,7-naphthyridine, 97%, 5-Bromo-8-methoxy-1,7-naphthyridine, 95%, 95%. Offered by: Biosynth, Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 100mg, 1g, 5g, 250mg, 500mg, 2.5g.
5-bromo-8-methoxy-1,7-naphthyridine (CAS 1447965-76-5) is a chemical compound with the molecular formula C9H7BrN2O and a molecular weight of 239.07 g/mol. IUPAC name: 5-bromo-8-methoxy-1,7-naphthyridine. InChIKey: GJKRAZSBXOSEDJ-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O |
|---|---|
| Molecular weight | 239.07 g/mol |
| IUPAC name | 5-bromo-8-methoxy-1,7-naphthyridine |
| InChIKey | GJKRAZSBXOSEDJ-UHFFFAOYSA-N |
| SMILES | COC1=NC=C(C2=C1N=CC=C2)Br |
Computed by PubChem (NCBI)