CAS 144841-10-1 appears in our catalog under these names: Apremilast Impurity 125, 3-(Acetylamino)-1,2-benzenedicarboxylic Acid Methyl Ester. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg, 25mg, 5mg.
2-acetamido-6-methoxycarbonylbenzoic acid (CAS 144841-10-1) is a chemical compound with the molecular formula C11H11NO5 and a molecular weight of 237.21 g/mol. IUPAC name: 2-acetamido-6-methoxycarbonylbenzoic acid. InChIKey: YIHCHQXHOOQFOD-UHFFFAOYSA-N.
| Molecular formula | C11H11NO5 |
|---|---|
| Molecular weight | 237.21 g/mol |
| IUPAC name | 2-acetamido-6-methoxycarbonylbenzoic acid |
| InChIKey | YIHCHQXHOOQFOD-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=CC(=C1C(=O)O)C(=O)OC |
Computed by PubChem (NCBI)