Products 1449132-27-7
CAS 1449132-27-7 appears in our catalog under these names: N-(3-Chlorophenylsulfonyl)-dl-phenylalanine, 95%, ((3–Chlorophenyl)sulfonyl)phenylalanine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
2-[(3-chlorophenyl)sulfonylamino]-3-phenylpropanoic acid (CAS 1449132-27-7) is a chemical compound with the molecular formula C15H14ClNO4S and a molecular weight of 339.8 g/mol. IUPAC name: 2-[(3-chlorophenyl)sulfonylamino]-3-phenylpropanoic acid. InChIKey: XZBAIPMBXLSRKT-UHFFFAOYSA-N.
| Molecular formula | C15H14ClNO4S |
|---|---|
| Molecular weight | 339.8 g/mol |
| IUPAC name | 2-[(3-chlorophenyl)sulfonylamino]-3-phenylpropanoic acid |
| InChIKey | XZBAIPMBXLSRKT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(C(=O)O)NS(=O)(=O)C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)