CAS 333459-19-1 is the registry number for N-(2-Chlorophenyl)-n-[(4-methylphenyl)sulfonyl]glycine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(2-chloro-N-(4-methylphenyl)sulfonylanilino)acetic acid (CAS 333459-19-1) is a chemical compound with the molecular formula C15H14ClNO4S and a molecular weight of 339.8 g/mol. IUPAC name: 2-(2-chloro-N-(4-methylphenyl)sulfonylanilino)acetic acid. InChIKey: HIYIQDTVQNZMSU-UHFFFAOYSA-N.
| Molecular formula | C15H14ClNO4S |
|---|---|
| Molecular weight | 339.8 g/mol |
| IUPAC name | 2-(2-chloro-N-(4-methylphenyl)sulfonylanilino)acetic acid |
| InChIKey | HIYIQDTVQNZMSU-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N(CC(=O)O)C2=CC=CC=C2Cl |
Computed by PubChem (NCBI)