CAS 327106-17-2 is the registry number for 2-Chloro-5-(3,4-dimethyl-phenylsulfamoyl)-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
2-chloro-5-[(3,4-dimethylphenyl)sulfamoyl]benzoic acid (CAS 327106-17-2) is a chemical compound with the molecular formula C15H14ClNO4S and a molecular weight of 339.8 g/mol. IUPAC name: 2-chloro-5-[(3,4-dimethylphenyl)sulfamoyl]benzoic acid. InChIKey: OKKFXFCGXAUYLY-UHFFFAOYSA-N.
| Molecular formula | C15H14ClNO4S |
|---|---|
| Molecular weight | 339.8 g/mol |
| IUPAC name | 2-chloro-5-[(3,4-dimethylphenyl)sulfamoyl]benzoic acid |
| InChIKey | OKKFXFCGXAUYLY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NS(=O)(=O)C2=CC(=C(C=C2)Cl)C(=O)O)C |
Computed by PubChem (NCBI)