Products 327106-17-2

CAS 327106-17-2 is the registry number for 2-Chloro-5-(3,4-dimethyl-phenylsulfamoyl)-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

2-chloro-5-[(3,4-dimethylphenyl)sulfamoyl]benzoic acid (CAS 327106-17-2) is a chemical compound with the molecular formula C15H14ClNO4S and a molecular weight of 339.8 g/mol. IUPAC name: 2-chloro-5-[(3,4-dimethylphenyl)sulfamoyl]benzoic acid. InChIKey: OKKFXFCGXAUYLY-UHFFFAOYSA-N.

Identity
Molecular formulaC15H14ClNO4S
Molecular weight339.8 g/mol
IUPAC name2-chloro-5-[(3,4-dimethylphenyl)sulfamoyl]benzoic acid
InChIKeyOKKFXFCGXAUYLY-UHFFFAOYSA-N
SMILESCC1=C(C=C(C=C1)NS(=O)(=O)C2=CC(=C(C=C2)Cl)C(=O)O)C

Computed by PubChem (NCBI)