Products 380193-44-2
CAS 380193-44-2 appears in our catalog under these names: 5-(Benzyl(methyl)sulfamoyl)-2-chlorobenzoic acid, 95%, 5-(Benzyl-methyl-sulfamoyl)-2-chloro-benzoic acid, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg.
5-[benzyl(methyl)sulfamoyl]-2-chlorobenzoic acid (CAS 380193-44-2) is a chemical compound with the molecular formula C15H14ClNO4S and a molecular weight of 339.8 g/mol. IUPAC name: 5-[benzyl(methyl)sulfamoyl]-2-chlorobenzoic acid. InChIKey: OZKYTVRFQCGZKP-UHFFFAOYSA-N.
| Molecular formula | C15H14ClNO4S |
|---|---|
| Molecular weight | 339.8 g/mol |
| IUPAC name | 5-[benzyl(methyl)sulfamoyl]-2-chlorobenzoic acid |
| InChIKey | OZKYTVRFQCGZKP-UHFFFAOYSA-N |
| SMILES | CN(CC1=CC=CC=C1)S(=O)(=O)C2=CC(=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)