Products 332057-66-6

CAS 332057-66-6 is the registry number for 4-[(4-Chlorobenzyl)(methylsulfonyl)amino]benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

4-[(4-chlorophenyl)methyl-methylsulfonylamino]benzoic acid (CAS 332057-66-6) is a chemical compound with the molecular formula C15H14ClNO4S and a molecular weight of 339.8 g/mol. IUPAC name: 4-[(4-chlorophenyl)methyl-methylsulfonylamino]benzoic acid. InChIKey: PSRBPWWNHRUUQP-UHFFFAOYSA-N.

Identity
Molecular formulaC15H14ClNO4S
Molecular weight339.8 g/mol
IUPAC name4-[(4-chlorophenyl)methyl-methylsulfonylamino]benzoic acid
InChIKeyPSRBPWWNHRUUQP-UHFFFAOYSA-N
SMILESCS(=O)(=O)N(CC1=CC=C(C=C1)Cl)C2=CC=C(C=C2)C(=O)O

Computed by PubChem (NCBI)