Products 406927-75-1
CAS 406927-75-1 appears in our catalog under these names: 2-Chloro-5-[ethyl(phenyl)sulfamoyl]benzoic acid, 95%, 2-Chloro-5-(ethyl(phenyl)sulfamoyl)benzoic acid, 95%, 2-Chloro-5-(ethyl(phenyl)sulfamoyl)benzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
2-chloro-5-[ethyl(phenyl)sulfamoyl]benzoic acid (CAS 406927-75-1) is a chemical compound with the molecular formula C15H14ClNO4S and a molecular weight of 339.8 g/mol. IUPAC name: 2-chloro-5-[ethyl(phenyl)sulfamoyl]benzoic acid. InChIKey: PNIGVEBGWOEVFD-UHFFFAOYSA-N.
| Molecular formula | C15H14ClNO4S |
|---|---|
| Molecular weight | 339.8 g/mol |
| IUPAC name | 2-chloro-5-[ethyl(phenyl)sulfamoyl]benzoic acid |
| InChIKey | PNIGVEBGWOEVFD-UHFFFAOYSA-N |
| SMILES | CCN(C1=CC=CC=C1)S(=O)(=O)C2=CC(=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)