Products 1449582-78-8
CAS 1449582-78-8 is the registry number for (2E)-3-(1-Methyl-1h-indol-5-yl)acrylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(E)-3-(1-methylindol-5-yl)prop-2-enoic acid (CAS 1449582-78-8) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. IUPAC name: (E)-3-(1-methylindol-5-yl)prop-2-enoic acid. InChIKey: IZZVPUQKWOCNSS-HWKANZROSA-N.
| Molecular formula | C12H11NO2 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | (E)-3-(1-methylindol-5-yl)prop-2-enoic acid |
| InChIKey | IZZVPUQKWOCNSS-HWKANZROSA-N |
| SMILES | CN1C=CC2=C1C=CC(=C2)/C=C/C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(2E)-3-(1-methyl-1H-indol-5-yl)acrylic acid, (E)-3-(1-Methyl-1H-indol-5-yl)acrylic acid, (2E)-3-(1-methyl-1H-indol-5-yl)prop-2-enoic acid, (E)-3-(1-methylindol-5-yl)prop-2-enoic acid, 3-(1-methyl-1H-indol-5-yl)prop-2-enoic acid, 2-propenoic acid, 3-(1-methyl-1H-indol-5-yl)-, (2E)-, (E)-3-(1-Methyl-1H-indol-5-yl)acrylicacid