CAS 14510-37-3 is the registry number for Atropine Impurity 10. Offered by: Chemat Brand. Available pack sizes: on request.
(3-chloro-3-oxo-2-phenylpropyl) acetate (CAS 14510-37-3) is a chemical compound with the molecular formula C11H11ClO3 and a molecular weight of 226.65 g/mol. IUPAC name: (3-chloro-3-oxo-2-phenylpropyl) acetate. InChIKey: PWWISFVVAKCNEF-UHFFFAOYSA-N.
| Molecular formula | C11H11ClO3 |
|---|---|
| Molecular weight | 226.65 g/mol |
| IUPAC name | (3-chloro-3-oxo-2-phenylpropyl) acetate |
| InChIKey | PWWISFVVAKCNEF-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC(C1=CC=CC=C1)C(=O)Cl |
Computed by PubChem (NCBI)