Products 145348-28-3
CAS 145348-28-3 is the registry number for 6,8-Difluoro-2,3,4,5-tetrahydro-1-benzoxepin-5-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6,8-difluoro-3,4-dihydro-2H-1-benzoxepin-5-one (CAS 145348-28-3) is a chemical compound with the molecular formula C10H8F2O2 and a molecular weight of 198.17 g/mol. IUPAC name: 6,8-difluoro-3,4-dihydro-2H-1-benzoxepin-5-one. InChIKey: CIIKURZNKXRZJL-UHFFFAOYSA-N.
| Molecular formula | C10H8F2O2 |
|---|---|
| Molecular weight | 198.17 g/mol |
| IUPAC name | 6,8-difluoro-3,4-dihydro-2H-1-benzoxepin-5-one |
| InChIKey | CIIKURZNKXRZJL-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C(C=C(C=C2F)F)OC1 |
Computed by PubChem (NCBI)