CAS 1455122-90-3 appears in our catalog under these names: 4-((2,4-Dimethoxyphenyl)amino)benzoic acid, 95%, 4-((2,4-Dimethoxyphenyl)amino)benzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
4-(2,4-dimethoxyanilino)benzoic acid (CAS 1455122-90-3) is a chemical compound with the molecular formula C15H15NO4 and a molecular weight of 273.28 g/mol. IUPAC name: 4-(2,4-dimethoxyanilino)benzoic acid. InChIKey: XGHMCOKWFSCGGX-UHFFFAOYSA-N.
| Molecular formula | C15H15NO4 |
|---|---|
| Molecular weight | 273.28 g/mol |
| IUPAC name | 4-(2,4-dimethoxyanilino)benzoic acid |
| InChIKey | XGHMCOKWFSCGGX-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)NC2=CC=C(C=C2)C(=O)O)OC |
Computed by PubChem (NCBI)