CAS 1455991-37-3 is the registry number for 4-((1,3-Dioxo-2,3-dihydro-1H-isoindol-2-yl)methyl)-5-methylfuran-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-[(1,3-dioxoisoindol-2-yl)methyl]-5-methylfuran-2-carboxylic acid (CAS 1455991-37-3) is a chemical compound with the molecular formula C15H11NO5 and a molecular weight of 285.25 g/mol. IUPAC name: 4-[(1,3-dioxoisoindol-2-yl)methyl]-5-methylfuran-2-carboxylic acid. InChIKey: WNDJBISSYRAIIO-UHFFFAOYSA-N.
| Molecular formula | C15H11NO5 |
|---|---|
| Molecular weight | 285.25 g/mol |
| IUPAC name | 4-[(1,3-dioxoisoindol-2-yl)methyl]-5-methylfuran-2-carboxylic acid |
| InChIKey | WNDJBISSYRAIIO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(O1)C(=O)O)CN2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)